C23H27F3N6O4 — CID 10391543
(2S,3S,4R)-6-amino-2-(dimethoxymethyl)-2-methyl-4-[N-[(2-methyltetrazol-5-yl)methyl]-4-(trifluoromethyl)anilino]-3,4-dihydrochromen-3-ol (PubChem CID 10391543) has the molecular formula C23H27F3N6O4 and a molecular weight of 508.50 g/mol. Its IUPAC name is (2S,3S,4R)-6-amino-2-(dimethoxymethyl)-2-methyl-4-[N-[(2-methyltetrazol-5-yl)methyl]-4-(trifluoromethyl)anilino]-3,4-dihydrochromen-3-ol.
| Compound Name | (2S,3S,4R)-6-amino-2-(dimethoxymethyl)-2-methyl-4-[N-[(2-methyltetrazol-5-yl)methyl]-4-(trifluoromethyl)anilino]-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 10391543 |
| Molecular Formula | C23H27F3N6O4 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | (2S,3S,4R)-6-amino-2-(dimethoxymethyl)-2-methyl-4-[N-[(2-methyltetrazol-5-yl)methyl]-4-(trifluoromethyl)anilino]-3,4-dihydrochromen-3-ol |
| SMILES | COC(OC)[C@@]1(C)Oc2ccc(N)cc2[C@@H](N(Cc2nnn(C)n2)c2ccc(C(F)(F)F)cc2)[C@@H]1O |
| InChI | InChI=1S/C23H27F3N6O4/c1-22(21(34-3)35-4)20(33)19(16-11-14(27)7-10-17(16)36-22)32(12-18-28-30-31(2)29-18)15-8-5-13(6-9-15)23(24,25)26/h5-11,19-21,33H,12,27H2,1-4H3/t19-,20+,22+/m1/s1 |
| InChIKey | PBGFAOJGZMHKLU-URVUXULASA-N |
| XLogP | 2.69 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|