C15H18F3NO2 — CID 103915450
(E)-3-(2,4-dimethylphenyl)-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 103915450) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is (E)-3-(2,4-dimethylphenyl)-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethylphenyl)-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 103915450 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (E)-3-(2,4-dimethylphenyl)-N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)N(CCO)CC(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C15H18F3NO2/c1-11-3-4-13(12(2)9-11)5-6-14(21)19(7-8-20)10-15(16,17)18/h3-6,9,20H,7-8,10H2,1-2H3/b6-5+ |
| InChIKey | PMTIQJRZMVTQNC-AATRIKPKSA-N |
| XLogP | 2.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|