C29H32N8O — CID 10391554
1-(4-benzhydrylpiperazin-1-yl)-3-[6-(2-methylimidazol-1-yl)purin-9-yl]propan-2-ol (PubChem CID 10391554) has the molecular formula C29H32N8O and a molecular weight of 508.63 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-3-[6-(2-methylimidazol-1-yl)purin-9-yl]propan-2-ol.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-3-[6-(2-methylimidazol-1-yl)purin-9-yl]propan-2-ol |
|---|---|
| PubChem CID | 10391554 |
| Molecular Formula | C29H32N8O |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-3-[6-(2-methylimidazol-1-yl)purin-9-yl]propan-2-ol |
| SMILES | Cc1nccn1-c1ncnc2c1ncn2CC(O)CN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H32N8O/c1-22-30-12-13-37(22)29-26-28(31-20-32-29)36(21-33-26)19-25(38)18-34-14-16-35(17-15-34)27(23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-13,20-21,25,27,38H,14-19H2,1H3 |
| InChIKey | LPHDCIWVOPKFOI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |