C27H26O6S2 — CID 10391614
1-[(2S,4aR,6R,7R,8R,8aR)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2,2-bis(phenylsulfanyl)ethanone (PubChem CID 10391614) has the molecular formula C27H26O6S2 and a molecular weight of 510.63 g/mol. Its IUPAC name is 1-[(2S,4aR,6R,7R,8R,8aR)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2,2-bis(phenylsulfanyl)ethanone.
| Compound Name | 1-[(2S,4aR,6R,7R,8R,8aR)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2,2-bis(phenylsulfanyl)ethanone |
|---|---|
| PubChem CID | 10391614 |
| Molecular Formula | C27H26O6S2 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 1-[(2S,4aR,6R,7R,8R,8aR)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-2,2-bis(phenylsulfanyl)ethanone |
| SMILES | O=C(C(Sc1ccccc1)Sc1ccccc1)[C@@H]1O[C@@H]2CO[C@H](c3ccccc3)O[C@@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H26O6S2/c28-21-22(29)25(32-20-16-31-26(33-24(20)21)17-10-4-1-5-11-17)23(30)27(34-18-12-6-2-7-13-18)35-19-14-8-3-9-15-19/h1-15,20-22,24-29H,16H2/t20-,21-,22-,24+,25-,26+/m1/s1 |
| InChIKey | HZVYUBODMHCMQZ-GGIDKDHVSA-N |
| XLogP | 4.07 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|