About N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide
N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide (PubChem CID 103916497) has the molecular formula C10H23NO3S
and a molecular weight of 237.36 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide |
| PubChem CID | 103916497 |
| Molecular Formula | C10H23NO3S |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide |
| SMILES | CC(O)CN(C)S(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C10H23NO3S/c1-9(12)8-11(5)15(13,14)7-6-10(2,3)4/h9,12H,6-8H2,1-5H3 |
| InChIKey | VDJMYDMYPFUOJY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide?
The IUPAC name of N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide (CID 103916497) is N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide.
What is the SMILES notation for N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide?
The canonical SMILES for N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide is CC(O)CN(C)S(=O)(=O)CCC(C)(C)C.
What is the InChIKey of N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide?
The InChIKey is VDJMYDMYPFUOJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO3S/c1-9(12)8-11(5)15(13,14)7-6-10(2,3)4/h9,12H,6-8H2,1-5H3.
What are the key properties of N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide?
N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide has a molecular weight of 237.36 g/mol, XLogP of 1.07, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxypropyl)-N,3,3-trimethylbutane-1-sulfonamide is sourced from PubChem (CID 103916497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).