C17H28N2O — CID 103917285
3-[1-(4-ethylphenyl)propylamino]-N,2,2-trimethylpropanamide (PubChem CID 103917285) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 3-[1-(4-ethylphenyl)propylamino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[1-(4-ethylphenyl)propylamino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 103917285 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 3-[1-(4-ethylphenyl)propylamino]-N,2,2-trimethylpropanamide |
| SMILES | CCc1ccc(C(CC)NCC(C)(C)C(=O)NC)cc1 |
| InChI | InChI=1S/C17H28N2O/c1-6-13-8-10-14(11-9-13)15(7-2)19-12-17(3,4)16(20)18-5/h8-11,15,19H,6-7,12H2,1-5H3,(H,18,20) |
| InChIKey | DOBOSTOZCUSWRU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |