About 5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide
5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide (PubChem CID 10391782) has the molecular formula C14H19Br3N4S
and a molecular weight of 515.11 g/mol. Its IUPAC name is 5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide |
| PubChem CID | 10391782 |
| Molecular Formula | C14H19Br3N4S |
| Molecular Weight | 515.11 g/mol |
| Exact Mass | 511.89 |
| IUPAC Name | 5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide |
| SMILES | Br.Br.CN1CCN(C2=NN=C(c3ccc(Br)cc3)CS2)CC1 |
| InChI | InChI=1S/C14H17BrN4S.2BrH/c1-18-6-8-19(9-7-18)14-17-16-13(10-20-14)11-2-4-12(15)5-3-11;;/h2-5H,6-10H2,1H3;2*1H |
| InChIKey | ATHARWJMEJCBSW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 515.11 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide?
The IUPAC name of 5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide (CID 10391782) is 5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide.
What is the SMILES notation for 5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide?
The canonical SMILES for 5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide is Br.Br.CN1CCN(C2=NN=C(c3ccc(Br)cc3)CS2)CC1.
What is the InChIKey of 5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide?
The InChIKey is ATHARWJMEJCBSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN4S.2BrH/c1-18-6-8-19(9-7-18)14-17-16-13(10-20-14)11-2-4-12(15)5-3-11;;/h2-5H,6-10H2,1H3;2*1H.
What are the key properties of 5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide?
5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide has a molecular weight of 515.11 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-2-(4-methylpiperazin-1-yl)-6H-1,3,4-thiadiazine;dihydrobromide is sourced from PubChem (CID 10391782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).