C11H13Br2NO2 — CID 103917970
(3R)-1-[(3,5-dibromo-2-hydroxyphenyl)methyl]pyrrolidin-3-ol (PubChem CID 103917970) has the molecular formula C11H13Br2NO2 and a molecular weight of 351.04 g/mol. Its IUPAC name is (3R)-1-[(3,5-dibromo-2-hydroxyphenyl)methyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[(3,5-dibromo-2-hydroxyphenyl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 103917970 |
| Molecular Formula | C11H13Br2NO2 |
| Molecular Weight | 351.04 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | (3R)-1-[(3,5-dibromo-2-hydroxyphenyl)methyl]pyrrolidin-3-ol |
| SMILES | Oc1c(Br)cc(Br)cc1CN1CC[C@@H](O)C1 |
| InChI | InChI=1S/C11H13Br2NO2/c12-8-3-7(11(16)10(13)4-8)5-14-2-1-9(15)6-14/h3-4,9,15-16H,1-2,5-6H2/t9-/m1/s1 |
| InChIKey | BZTSUYFOYVDIQV-SECBINFHSA-N |
| XLogP | 2.48 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.04 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|