C24H23ClF2N6O3 — CID 10391848
N-[[5-chloro-2-(methylaminomethyl)phenyl]methyl]-2-[3-cyano-6-[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]imino-1-hydroxy-2-pyridinyl]acetamide (PubChem CID 10391848) has the molecular formula C24H23ClF2N6O3 and a molecular weight of 516.94 g/mol. Its IUPAC name is N-[[5-chloro-2-(methylaminomethyl)phenyl]methyl]-2-[3-cyano-6-[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]imino-1-hydroxy-2-pyridinyl]acetamide.
| Compound Name | N-[[5-chloro-2-(methylaminomethyl)phenyl]methyl]-2-[3-cyano-6-[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]imino-1-hydroxy-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 10391848 |
| Molecular Formula | C24H23ClF2N6O3 |
| Molecular Weight | 516.94 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | N-[[5-chloro-2-(methylaminomethyl)phenyl]methyl]-2-[3-cyano-6-[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]imino-1-hydroxy-2-pyridinyl]acetamide |
| SMILES | CNCc1ccc(Cl)cc1CNC(=O)Cc1c(C#N)cc/c(=N\CC(F)(F)c2cccc[n+]2[O-])n1O |
| InChI | InChI=1S/C24H23ClF2N6O3/c1-29-13-17-5-7-19(25)10-18(17)14-30-23(34)11-20-16(12-28)6-8-22(33(20)36)31-15-24(26,27)21-4-2-3-9-32(21)35/h2-10,29,36H,11,13-15H2,1H3,(H,30,34)/b31-22+ |
| InChIKey | AJNHXKMFZWOLPB-DFKUXCBWSA-N |
| XLogP | 2.15 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.94 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|