C26H32N8O4 — CID 10391950
methyl 4-[[2-butyl-5-[(Z)-[1-butyl-2,5-dioxo-3-(2H-tetrazol-5-ylmethyl)imidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate (PubChem CID 10391950) has the molecular formula C26H32N8O4 and a molecular weight of 520.59 g/mol. Its IUPAC name is methyl 4-[[2-butyl-5-[(Z)-[1-butyl-2,5-dioxo-3-(2H-tetrazol-5-ylmethyl)imidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[2-butyl-5-[(Z)-[1-butyl-2,5-dioxo-3-(2H-tetrazol-5-ylmethyl)imidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 10391950 |
| Molecular Formula | C26H32N8O4 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | methyl 4-[[2-butyl-5-[(Z)-[1-butyl-2,5-dioxo-3-(2H-tetrazol-5-ylmethyl)imidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate |
| SMILES | CCCCc1ncc(/C=C2/C(=O)N(CCCC)C(=O)N2Cc2nn[nH]n2)n1Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C26H32N8O4/c1-4-6-8-23-27-15-20(33(23)16-18-9-11-19(12-10-18)25(36)38-3)14-21-24(35)32(13-7-5-2)26(37)34(21)17-22-28-30-31-29-22/h9-12,14-15H,4-8,13,16-17H2,1-3H3,(H,28,29,30,31)/b21-14- |
| InChIKey | SKNMDFCVYBECQT-STZFKDTASA-N |
| XLogP | 3.18 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|