C10H15NO2S — CID 103920243
N-[(2R)-1-hydroxybutan-2-yl]-2-thiophen-3-ylacetamide (PubChem CID 103920243) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is N-[(2R)-1-hydroxybutan-2-yl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[(2R)-1-hydroxybutan-2-yl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 103920243 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | N-[(2R)-1-hydroxybutan-2-yl]-2-thiophen-3-ylacetamide |
| SMILES | CC[C@H](CO)NC(=O)Cc1ccsc1 |
| InChI | InChI=1S/C10H15NO2S/c1-2-9(6-12)11-10(13)5-8-3-4-14-7-8/h3-4,7,9,12H,2,5-6H2,1H3,(H,11,13)/t9-/m1/s1 |
| InChIKey | IPTCORWDRJJGPZ-SECBINFHSA-N |
| XLogP | 1.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |