C14H22N2O4S — CID 103920276
N-[(2R)-1-hydroxybutan-2-yl]-4-(propan-2-ylsulfamoyl)benzamide (PubChem CID 103920276) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-[(2R)-1-hydroxybutan-2-yl]-4-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-[(2R)-1-hydroxybutan-2-yl]-4-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 103920276 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-[(2R)-1-hydroxybutan-2-yl]-4-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CC[C@H](CO)NC(=O)c1ccc(S(=O)(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C14H22N2O4S/c1-4-12(9-17)15-14(18)11-5-7-13(8-6-11)21(19,20)16-10(2)3/h5-8,10,12,16-17H,4,9H2,1-3H3,(H,15,18)/t12-/m1/s1 |
| InChIKey | NXMDXVQXLSAMJK-GFCCVEGCSA-N |
| XLogP | 0.87 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |