C30H32N6O3 — CID 10392075
ethyl 2-(N-[2-[(4-carbamimidoyl-N-methylanilino)methyl]-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-6-carbonyl]anilino)acetate (PubChem CID 10392075) has the molecular formula C30H32N6O3 and a molecular weight of 524.63 g/mol. Its IUPAC name is ethyl 2-(N-[2-[(4-carbamimidoyl-N-methylanilino)methyl]-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-6-carbonyl]anilino)acetate.
| Compound Name | ethyl 2-(N-[2-[(4-carbamimidoyl-N-methylanilino)methyl]-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-6-carbonyl]anilino)acetate |
|---|---|
| PubChem CID | 10392075 |
| Molecular Formula | C30H32N6O3 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | ethyl 2-(N-[2-[(4-carbamimidoyl-N-methylanilino)methyl]-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-6-carbonyl]anilino)acetate |
| SMILES | [H]/N=C(\N)c1ccc(N(C)Cc2nc3cc(C(=O)N(CC(=O)OCC)c4ccccc4)cc4c3n2CCC4)cc1 |
| InChI | InChI=1S/C30H32N6O3/c1-3-39-27(37)19-36(24-9-5-4-6-10-24)30(38)22-16-21-8-7-15-35-26(33-25(17-22)28(21)35)18-34(2)23-13-11-20(12-14-23)29(31)32/h4-6,9-14,16-17H,3,7-8,15,18-19H2,1-2H3,(H3,31,32) |
| InChIKey | BLLIIVIPFPYSDN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|