C16H31NO2 — CID 103922073
N-(2-but-3-enoxyethyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine (PubChem CID 103922073) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine.
| Compound Name | N-(2-but-3-enoxyethyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine |
|---|---|
| PubChem CID | 103922073 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-2,2-dimethyl-3-(2-methylpropoxy)cyclobutan-1-amine |
| SMILES | C=CCCOCCNC1CC(OCC(C)C)C1(C)C |
| InChI | InChI=1S/C16H31NO2/c1-6-7-9-18-10-8-17-14-11-15(16(14,4)5)19-12-13(2)3/h6,13-15,17H,1,7-12H2,2-5H3 |
| InChIKey | YKTIBKZUXGFYEJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|