C14H21NO4 — CID 103923807
methyl 2-methyl-5-[[(2-methyloxan-4-yl)amino]methyl]furan-3-carboxylate (PubChem CID 103923807) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is methyl 2-methyl-5-[[(2-methyloxan-4-yl)amino]methyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[[(2-methyloxan-4-yl)amino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 103923807 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | methyl 2-methyl-5-[[(2-methyloxan-4-yl)amino]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(CNC2CCOC(C)C2)oc1C |
| InChI | InChI=1S/C14H21NO4/c1-9-6-11(4-5-18-9)15-8-12-7-13(10(2)19-12)14(16)17-3/h7,9,11,15H,4-6,8H2,1-3H3 |
| InChIKey | KSKYBUVXNNJSGR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |