About (2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one
(2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one (PubChem CID 103928383) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is (2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one.
Molecular Properties
| Compound Name | (2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one |
| PubChem CID | 103928383 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one |
| SMILES | CC1CCCC(C)N1C(=O)[C@H](N)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O/c1-9-7-6-8-10(2)15(9)12(16)11(14)13(3,4)5/h9-11H,6-8,14H2,1-5H3/t9?,10?,11-/m0/s1 |
| InChIKey | YYQQGCWSVNJQOT-ILDUYXDCSA-N |
| XLogP | 2.15 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one?
The IUPAC name of (2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one (CID 103928383) is (2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one.
What is the SMILES notation for (2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one?
The canonical SMILES for (2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one is CC1CCCC(C)N1C(=O)[C@H](N)C(C)(C)C.
What is the InChIKey of (2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one?
The InChIKey is YYQQGCWSVNJQOT-ILDUYXDCSA-N. The full InChI is InChI=1S/C13H26N2O/c1-9-7-6-8-10(2)15(9)12(16)11(14)13(3,4)5/h9-11H,6-8,14H2,1-5H3/t9?,10?,11-/m0/s1.
What are the key properties of (2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one?
(2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one has a molecular weight of 226.36 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-1-(2,6-dimethylpiperidin-1-yl)-3,3-dimethylbutan-1-one is sourced from PubChem (CID 103928383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).