C15H24N2O3 — CID 103928800
(2R)-2-amino-N-(4-ethoxy-3-methoxyphenyl)-3,3-dimethylbutanamide (PubChem CID 103928800) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is (2R)-2-amino-N-(4-ethoxy-3-methoxyphenyl)-3,3-dimethylbutanamide.
| Compound Name | (2R)-2-amino-N-(4-ethoxy-3-methoxyphenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 103928800 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2R)-2-amino-N-(4-ethoxy-3-methoxyphenyl)-3,3-dimethylbutanamide |
| SMILES | CCOc1ccc(NC(=O)[C@H](N)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C15H24N2O3/c1-6-20-11-8-7-10(9-12(11)19-5)17-14(18)13(16)15(2,3)4/h7-9,13H,6,16H2,1-5H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | OBPDRQXIDOIOEW-ZDUSSCGKSA-N |
| XLogP | 2.41 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |