C13H20N2O2 — CID 103930188
(2R)-2-amino-N-(2-hydroxy-3-methylphenyl)-3,3-dimethylbutanamide (PubChem CID 103930188) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-hydroxy-3-methylphenyl)-3,3-dimethylbutanamide.
| Compound Name | (2R)-2-amino-N-(2-hydroxy-3-methylphenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 103930188 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (2R)-2-amino-N-(2-hydroxy-3-methylphenyl)-3,3-dimethylbutanamide |
| SMILES | Cc1cccc(NC(=O)[C@H](N)C(C)(C)C)c1O |
| InChI | InChI=1S/C13H20N2O2/c1-8-6-5-7-9(10(8)16)15-12(17)11(14)13(2,3)4/h5-7,11,16H,14H2,1-4H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | XXSIENUSDIKIBG-NSHDSACASA-N |
| XLogP | 2.01 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|