C11H20F3NO2 — CID 103930671
1,1,1-trifluoro-3-[(2-propan-2-yloxan-4-yl)amino]propan-2-ol (PubChem CID 103930671) has the molecular formula C11H20F3NO2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[(2-propan-2-yloxan-4-yl)amino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[(2-propan-2-yloxan-4-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 103930671 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1,1,1-trifluoro-3-[(2-propan-2-yloxan-4-yl)amino]propan-2-ol |
| SMILES | CC(C)C1CC(NCC(O)C(F)(F)F)CCO1 |
| InChI | InChI=1S/C11H20F3NO2/c1-7(2)9-5-8(3-4-17-9)15-6-10(16)11(12,13)14/h7-10,15-16H,3-6H2,1-2H3 |
| InChIKey | YFYDMQHVIDAYSG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |