C31H44Cl2N2O3 — CID 10393093
[(4aS,4bR,6aS,8R,10aR,10bS,12aS)-6a,10a,12a-trimethyl-2-oxo-1,3,4,4a,4b,5,6,7,8,9,10,10b,11,12-tetradecahydronaphtho[2,1-f]quinolin-8-yl] 3-[bis(2-chloroethyl)amino]benzoate (PubChem CID 10393093) has the molecular formula C31H44Cl2N2O3 and a molecular weight of 563.61 g/mol. Its IUPAC name is [(4aS,4bR,6aS,8R,10aR,10bS,12aS)-6a,10a,12a-trimethyl-2-oxo-1,3,4,4a,4b,5,6,7,8,9,10,10b,11,12-tetradecahydronaphtho[2,1-f]quinolin-8-yl] 3-[bis(2-chloroethyl)amino]benzoate.
| Compound Name | [(4aS,4bR,6aS,8R,10aR,10bS,12aS)-6a,10a,12a-trimethyl-2-oxo-1,3,4,4a,4b,5,6,7,8,9,10,10b,11,12-tetradecahydronaphtho[2,1-f]quinolin-8-yl] 3-[bis(2-chloroethyl)amino]benzoate |
|---|---|
| PubChem CID | 10393093 |
| Molecular Formula | C31H44Cl2N2O3 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | [(4aS,4bR,6aS,8R,10aR,10bS,12aS)-6a,10a,12a-trimethyl-2-oxo-1,3,4,4a,4b,5,6,7,8,9,10,10b,11,12-tetradecahydronaphtho[2,1-f]quinolin-8-yl] 3-[bis(2-chloroethyl)amino]benzoate |
| SMILES | C[C@@]12CC[C@H]3[C@@H]4CCC(=O)N[C@@]4(C)CC[C@@H]3[C@@]1(C)CC[C@@H](OC(=O)c1cccc(N(CCCl)CCCl)c1)C2 |
| InChI | InChI=1S/C31H44Cl2N2O3/c1-29-12-10-24-25(11-14-31(3)26(24)7-8-27(36)34-31)30(29,2)13-9-23(20-29)38-28(37)21-5-4-6-22(19-21)35(17-15-32)18-16-33/h4-6,19,23-26H,7-18,20H2,1-3H3,(H,34,36)/t23-,24-,25+,26+,29+,30-,31+/m1/s1 |
| InChIKey | WIAVPIXTTRPKNW-OMZLHZRKSA-N |
| XLogP | 6.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|