C29H27Na2O7P — CID 10393105
disodium;[3-(3'-methoxy-2,4-diphenylspiro[bicyclo[3.3.1]non-2-ene-9,4'-dioxetane]-3'-yl)phenyl] phosphate (PubChem CID 10393105) has the molecular formula C29H27Na2O7P and a molecular weight of 564.48 g/mol. Its IUPAC name is disodium;[3-(3'-methoxy-2,4-diphenylspiro[bicyclo[3.3.1]non-2-ene-9,4'-dioxetane]-3'-yl)phenyl] phosphate.
| Compound Name | disodium;[3-(3'-methoxy-2,4-diphenylspiro[bicyclo[3.3.1]non-2-ene-9,4'-dioxetane]-3'-yl)phenyl] phosphate |
|---|---|
| PubChem CID | 10393105 |
| Molecular Formula | C29H27Na2O7P |
| Molecular Weight | 564.48 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | disodium;[3-(3'-methoxy-2,4-diphenylspiro[bicyclo[3.3.1]non-2-ene-9,4'-dioxetane]-3'-yl)phenyl] phosphate |
| SMILES | COC1(c2cccc(OP(=O)([O-])[O-])c2)OOC12C1CCCC2C(c2ccccc2)C=C1c1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C29H29O7P.2Na/c1-33-29(22-14-8-15-23(18-22)34-37(30,31)32)28(35-36-29)26-16-9-17-27(28)25(21-12-6-3-7-13-21)19-24(26)20-10-4-2-5-11-20;;/h2-8,10-15,18-19,24,26-27H,9,16-17H2,1H3,(H2,30,31,32);;/q;2*+1/p-2 |
| InChIKey | VXGSULLDFWYMEI-UHFFFAOYSA-L |
| XLogP | -1.30 |
| TPSA | 100.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.48 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|