About 2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol
2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol (PubChem CID 103931449) has the molecular formula C9H18F3NO
and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol.
Molecular Properties
| Compound Name | 2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol |
| PubChem CID | 103931449 |
| Molecular Formula | C9H18F3NO |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol |
| SMILES | CC(CC(F)(F)F)NC(C)C(C)(C)O |
| InChI | InChI=1S/C9H18F3NO/c1-6(5-9(10,11)12)13-7(2)8(3,4)14/h6-7,13-14H,5H2,1-4H3 |
| InChIKey | FYIQEXJMAROERY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol?
The IUPAC name of 2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol (CID 103931449) is 2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol.
What is the SMILES notation for 2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol?
The canonical SMILES for 2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol is CC(CC(F)(F)F)NC(C)C(C)(C)O.
What is the InChIKey of 2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol?
The InChIKey is FYIQEXJMAROERY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3NO/c1-6(5-9(10,11)12)13-7(2)8(3,4)14/h6-7,13-14H,5H2,1-4H3.
What are the key properties of 2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol?
2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol has a molecular weight of 213.24 g/mol, XLogP of 2.08, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol is sourced from PubChem (CID 103931449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).