C17H24FNS — CID 103931829
N-[3-(2-fluorophenyl)cyclobutyl]-2-methylsulfanylcyclohexan-1-amine (PubChem CID 103931829) has the molecular formula C17H24FNS and a molecular weight of 293.45 g/mol. Its IUPAC name is N-[3-(2-fluorophenyl)cyclobutyl]-2-methylsulfanylcyclohexan-1-amine.
| Compound Name | N-[3-(2-fluorophenyl)cyclobutyl]-2-methylsulfanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 103931829 |
| Molecular Formula | C17H24FNS |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[3-(2-fluorophenyl)cyclobutyl]-2-methylsulfanylcyclohexan-1-amine |
| SMILES | CSC1CCCCC1NC1CC(c2ccccc2F)C1 |
| InChI | InChI=1S/C17H24FNS/c1-20-17-9-5-4-8-16(17)19-13-10-12(11-13)14-6-2-3-7-15(14)18/h2-3,6-7,12-13,16-17,19H,4-5,8-11H2,1H3 |
| InChIKey | SJJAOVOLTDCOTA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |