C9H4ClF4N3OS — CID 103931845
N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103931845) has the molecular formula C9H4ClF4N3OS and a molecular weight of 313.66 g/mol. Its IUPAC name is N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103931845 |
| Molecular Formula | C9H4ClF4N3OS |
| Molecular Weight | 313.66 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(Nc1c(Cl)ccc2nsnc12)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H4ClF4N3OS/c10-3-1-2-4-6(17-19-16-4)5(3)15-8(18)9(13,14)7(11)12/h1-2,7H,(H,15,18) |
| InChIKey | RBCKVBBYJKWTDV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.66 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|