C12H16N2O5 — CID 103932710
5-[methyl-[2-methyl-3-(methylamino)-3-oxopropyl]carbamoyl]furan-2-carboxylic acid (PubChem CID 103932710) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 5-[methyl-[2-methyl-3-(methylamino)-3-oxopropyl]carbamoyl]furan-2-carboxylic acid.
| Compound Name | 5-[methyl-[2-methyl-3-(methylamino)-3-oxopropyl]carbamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 103932710 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 5-[methyl-[2-methyl-3-(methylamino)-3-oxopropyl]carbamoyl]furan-2-carboxylic acid |
| SMILES | CNC(=O)C(C)CN(C)C(=O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C12H16N2O5/c1-7(10(15)13-2)6-14(3)11(16)8-4-5-9(19-8)12(17)18/h4-5,7H,6H2,1-3H3,(H,13,15)(H,17,18) |
| InChIKey | XHWSYUJFNTZYDV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |