C13H13ClINO4 — CID 103932758
1-(5-chloro-2-iodobenzoyl)-4-methoxypyrrolidine-2-carboxylic acid (PubChem CID 103932758) has the molecular formula C13H13ClINO4 and a molecular weight of 409.61 g/mol. Its IUPAC name is 1-(5-chloro-2-iodobenzoyl)-4-methoxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-(5-chloro-2-iodobenzoyl)-4-methoxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 103932758 |
| Molecular Formula | C13H13ClINO4 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 408.96 |
| IUPAC Name | 1-(5-chloro-2-iodobenzoyl)-4-methoxypyrrolidine-2-carboxylic acid |
| SMILES | COC1CC(C(=O)O)N(C(=O)c2cc(Cl)ccc2I)C1 |
| InChI | InChI=1S/C13H13ClINO4/c1-20-8-5-11(13(18)19)16(6-8)12(17)9-4-7(14)2-3-10(9)15/h2-4,8,11H,5-6H2,1H3,(H,18,19) |
| InChIKey | KRTBYRBGSINXMQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|