C31H48O6Si2 — CID 10393302
[(2R,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-3-methyl-4-[(2R)-oxiran-2-yl]butan-2-yl] acetate (PubChem CID 10393302) has the molecular formula C31H48O6Si2 and a molecular weight of 572.89 g/mol. Its IUPAC name is [(2R,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-3-methyl-4-[(2R)-oxiran-2-yl]butan-2-yl] acetate.
| Compound Name | [(2R,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-3-methyl-4-[(2R)-oxiran-2-yl]butan-2-yl] acetate |
|---|---|
| PubChem CID | 10393302 |
| Molecular Formula | C31H48O6Si2 |
| Molecular Weight | 572.89 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | [(2R,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-3-methyl-4-[(2R)-oxiran-2-yl]butan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@](C)(O)[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1CO1 |
| InChI | InChI=1S/C31H48O6Si2/c1-23(32)36-27(22-35-38(9,10)29(2,3)4)31(8,33)28(26-21-34-26)37-39(30(5,6)7,24-17-13-11-14-18-24)25-19-15-12-16-20-25/h11-20,26-28,33H,21-22H2,1-10H3/t26-,27-,28+,31+/m1/s1 |
| InChIKey | FTQRPJYAXAPBCI-IEVQEWPMSA-N |
| XLogP | 5.03 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.89 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|