C14H13BrN4 — CID 103934296
6-bromo-N-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]pyridin-3-amine (PubChem CID 103934296) has the molecular formula C14H13BrN4 and a molecular weight of 317.19 g/mol. Its IUPAC name is 6-bromo-N-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]pyridin-3-amine.
| Compound Name | 6-bromo-N-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 103934296 |
| Molecular Formula | C14H13BrN4 |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 6-bromo-N-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]pyridin-3-amine |
| SMILES | Cc1nc2ccccn2c1CNc1ccc(Br)nc1 |
| InChI | InChI=1S/C14H13BrN4/c1-10-12(19-7-3-2-4-14(19)18-10)9-16-11-5-6-13(15)17-8-11/h2-8,16H,9H2,1H3 |
| InChIKey | AXMVRMFWVSDNIP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|