C9H22N2 — CID 103934492
(2R)-1-N-methyl-1-N-pentan-3-ylpropane-1,2-diamine (PubChem CID 103934492) has the molecular formula C9H22N2 and a molecular weight of 158.29 g/mol. Its IUPAC name is (2R)-1-N-methyl-1-N-pentan-3-ylpropane-1,2-diamine.
| Compound Name | (2R)-1-N-methyl-1-N-pentan-3-ylpropane-1,2-diamine |
|---|---|
| PubChem CID | 103934492 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | (2R)-1-N-methyl-1-N-pentan-3-ylpropane-1,2-diamine |
| SMILES | CCC(CC)N(C)C[C@@H](C)N |
| InChI | InChI=1S/C9H22N2/c1-5-9(6-2)11(4)7-8(3)10/h8-9H,5-7,10H2,1-4H3/t8-/m1/s1 |
| InChIKey | FRGGYHQVHUVLCX-MRVPVSSYSA-N |
| XLogP | 1.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |