C10H23N3 — CID 103934614
(2S)-1-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]propan-2-amine (PubChem CID 103934614) has the molecular formula C10H23N3 and a molecular weight of 185.32 g/mol. Its IUPAC name is (2S)-1-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]propan-2-amine.
| Compound Name | (2S)-1-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]propan-2-amine |
|---|---|
| PubChem CID | 103934614 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.32 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | (2S)-1-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]propan-2-amine |
| SMILES | C[C@H](N)CN1CCCC1CN(C)C |
| InChI | InChI=1S/C10H23N3/c1-9(11)7-13-6-4-5-10(13)8-12(2)3/h9-10H,4-8,11H2,1-3H3/t9-,10?/m0/s1 |
| InChIKey | BWZABYNNVPALNF-RGURZIINSA-N |
| XLogP | 0.36 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |