C10H22N2 — CID 103934796
(2S)-1-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-amine (PubChem CID 103934796) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is (2S)-1-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-amine.
| Compound Name | (2S)-1-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 103934796 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (2S)-1-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-amine |
| SMILES | CCC1CCC(C)N1C[C@H](C)N |
| InChI | InChI=1S/C10H22N2/c1-4-10-6-5-9(3)12(10)7-8(2)11/h8-10H,4-7,11H2,1-3H3/t8-,9?,10?/m0/s1 |
| InChIKey | OOJGZTMJGJFZOH-IDKOKCKLSA-N |
| XLogP | 1.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |