C10H21NO — CID 103935109
(2R)-1-(2,4-dimethylpiperidin-1-yl)propan-2-ol (PubChem CID 103935109) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is (2R)-1-(2,4-dimethylpiperidin-1-yl)propan-2-ol.
| Compound Name | (2R)-1-(2,4-dimethylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 103935109 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (2R)-1-(2,4-dimethylpiperidin-1-yl)propan-2-ol |
| SMILES | CC1CCN(C[C@@H](C)O)C(C)C1 |
| InChI | InChI=1S/C10H21NO/c1-8-4-5-11(7-10(3)12)9(2)6-8/h8-10,12H,4-7H2,1-3H3/t8?,9?,10-/m1/s1 |
| InChIKey | IDERGJFKIOUJJZ-UDNWOFFPSA-N |
| XLogP | 1.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |