About 2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one
2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one (PubChem CID 103935454) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is 2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one |
| PubChem CID | 103935454 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one |
| SMILES | C[C@H](O)Cn1ncn(C)c1=O |
| InChI | InChI=1S/C6H11N3O2/c1-5(10)3-9-6(11)8(2)4-7-9/h4-5,10H,3H2,1-2H3/t5-/m0/s1 |
| InChIKey | CGTQUZMWVIFKSK-YFKPBYRVSA-N |
| XLogP | -1.04 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one?
The IUPAC name of 2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one (CID 103935454) is 2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one.
What is the SMILES notation for 2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one?
The canonical SMILES for 2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one is C[C@H](O)Cn1ncn(C)c1=O.
What is the InChIKey of 2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one?
The InChIKey is CGTQUZMWVIFKSK-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H11N3O2/c1-5(10)3-9-6(11)8(2)4-7-9/h4-5,10H,3H2,1-2H3/t5-/m0/s1.
What are the key properties of 2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one?
2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one has a molecular weight of 157.17 g/mol, XLogP of -1.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-2-hydroxypropyl]-4-methyl-1,2,4-triazol-3-one is sourced from PubChem (CID 103935454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).