C15H27NO2 — CID 103935710
2-(2-adamantylamino)-2-ethylpropane-1,3-diol (PubChem CID 103935710) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-(2-adamantylamino)-2-ethylpropane-1,3-diol.
| Compound Name | 2-(2-adamantylamino)-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 103935710 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2-(2-adamantylamino)-2-ethylpropane-1,3-diol |
| SMILES | CCC(CO)(CO)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C15H27NO2/c1-2-15(8-17,9-18)16-14-12-4-10-3-11(6-12)7-13(14)5-10/h10-14,16-18H,2-9H2,1H3 |
| InChIKey | GMZPCELGLPNMPK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |