C11H23NO3S — CID 103935804
3-[(1,1-dioxo-1,4-thiazepan-4-yl)methyl]pentan-3-ol (PubChem CID 103935804) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,4-thiazepan-4-yl)methyl]pentan-3-ol.
| Compound Name | 3-[(1,1-dioxo-1,4-thiazepan-4-yl)methyl]pentan-3-ol |
|---|---|
| PubChem CID | 103935804 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 3-[(1,1-dioxo-1,4-thiazepan-4-yl)methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CN1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H23NO3S/c1-3-11(13,4-2)10-12-6-5-8-16(14,15)9-7-12/h13H,3-10H2,1-2H3 |
| InChIKey | MGQCSVHUVVVSFP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |