C16H29N3 — CID 103936956
6-[(1R)-1-aminopropyl]-N,N-dibutylpyridin-3-amine (PubChem CID 103936956) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 6-[(1R)-1-aminopropyl]-N,N-dibutylpyridin-3-amine.
| Compound Name | 6-[(1R)-1-aminopropyl]-N,N-dibutylpyridin-3-amine |
|---|---|
| PubChem CID | 103936956 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 6-[(1R)-1-aminopropyl]-N,N-dibutylpyridin-3-amine |
| SMILES | CCCCN(CCCC)c1ccc([C@H](N)CC)nc1 |
| InChI | InChI=1S/C16H29N3/c1-4-7-11-19(12-8-5-2)14-9-10-16(18-13-14)15(17)6-3/h9-10,13,15H,4-8,11-12,17H2,1-3H3/t15-/m1/s1 |
| InChIKey | QUGPRZNOPIOKQV-OAHLLOKOSA-N |
| XLogP | 3.90 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |