C32H55N2O6P — CID 10393697
[(2S)-1-[[(2S,3S,5R)-6-(butylamino)-1-cyclohexyl-3-hydroxy-5-methyl-6-oxohexan-2-yl]amino]-1-oxohexan-2-yl]oxy-(3-phenylpropyl)phosphinic acid (PubChem CID 10393697) has the molecular formula C32H55N2O6P and a molecular weight of 594.77 g/mol. Its IUPAC name is [(2S)-1-[[(2S,3S,5R)-6-(butylamino)-1-cyclohexyl-3-hydroxy-5-methyl-6-oxohexan-2-yl]amino]-1-oxohexan-2-yl]oxy-(3-phenylpropyl)phosphinic acid.
| Compound Name | [(2S)-1-[[(2S,3S,5R)-6-(butylamino)-1-cyclohexyl-3-hydroxy-5-methyl-6-oxohexan-2-yl]amino]-1-oxohexan-2-yl]oxy-(3-phenylpropyl)phosphinic acid |
|---|---|
| PubChem CID | 10393697 |
| Molecular Formula | C32H55N2O6P |
| Molecular Weight | 594.77 g/mol |
| Exact Mass | 594.38 |
| IUPAC Name | [(2S)-1-[[(2S,3S,5R)-6-(butylamino)-1-cyclohexyl-3-hydroxy-5-methyl-6-oxohexan-2-yl]amino]-1-oxohexan-2-yl]oxy-(3-phenylpropyl)phosphinic acid |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@H](CC1CCCCC1)NC(=O)[C@H](CCCC)OP(=O)(O)CCCc1ccccc1 |
| InChI | InChI=1S/C32H55N2O6P/c1-4-6-20-30(40-41(38,39)22-14-19-26-15-10-8-11-16-26)32(37)34-28(24-27-17-12-9-13-18-27)29(35)23-25(3)31(36)33-21-7-5-2/h8,10-11,15-16,25,27-30,35H,4-7,9,12-14,17-24H2,1-3H3,(H,33,36)(H,34,37)(H,38,39)/t25-,28+,29+,30+/m1/s1 |
| InChIKey | MIHZWSQPXITQHW-NYMHPOLGSA-N |
| XLogP | 6.14 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.77 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|