C34H37N5O3S — CID 10393717
N-(benzenesulfonyl)-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylanilino]-2-phenylacetamide (PubChem CID 10393717) has the molecular formula C34H37N5O3S and a molecular weight of 595.77 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylanilino]-2-phenylacetamide.
| Compound Name | N-(benzenesulfonyl)-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylanilino]-2-phenylacetamide |
|---|---|
| PubChem CID | 10393717 |
| Molecular Formula | C34H37N5O3S |
| Molecular Weight | 595.77 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | N-(benzenesulfonyl)-2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylanilino]-2-phenylacetamide |
| SMILES | CCCN(c1ccc(Cn2c(CC)nc3c(C)cc(C)nc32)cc1)C(C(=O)NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H37N5O3S/c1-5-21-38(32(27-13-9-7-10-14-27)34(40)37-43(41,42)29-15-11-8-12-16-29)28-19-17-26(18-20-28)23-39-30(6-2)36-31-24(3)22-25(4)35-33(31)39/h7-20,22,32H,5-6,21,23H2,1-4H3,(H,37,40) |
| InChIKey | BUTJAOBQRVRNMR-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.77 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|