C12H18N2O — CID 103938348
(1R)-1-[5-[cyclopropyl(methyl)amino]-2-pyridinyl]propan-1-ol (PubChem CID 103938348) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (1R)-1-[5-[cyclopropyl(methyl)amino]-2-pyridinyl]propan-1-ol.
| Compound Name | (1R)-1-[5-[cyclopropyl(methyl)amino]-2-pyridinyl]propan-1-ol |
|---|---|
| PubChem CID | 103938348 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (1R)-1-[5-[cyclopropyl(methyl)amino]-2-pyridinyl]propan-1-ol |
| SMILES | CC[C@@H](O)c1ccc(N(C)C2CC2)cn1 |
| InChI | InChI=1S/C12H18N2O/c1-3-12(15)11-7-6-10(8-13-11)14(2)9-4-5-9/h6-9,12,15H,3-5H2,1-2H3/t12-/m1/s1 |
| InChIKey | ZTLRFENBTXMPSN-GFCCVEGCSA-N |
| XLogP | 2.12 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |