C10H22N2O — CID 103939668
(3R)-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidin-3-amine (PubChem CID 103939668) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is (3R)-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidin-3-amine.
| Compound Name | (3R)-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 103939668 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (3R)-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidin-3-amine |
| SMILES | CC(C)(C)OCCN1CC[C@@H](N)C1 |
| InChI | InChI=1S/C10H22N2O/c1-10(2,3)13-7-6-12-5-4-9(11)8-12/h9H,4-8,11H2,1-3H3/t9-/m1/s1 |
| InChIKey | QLJBSJWXGCZSSV-SECBINFHSA-N |
| XLogP | 0.83 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |