C37H49N5O3 — CID 10393978
(E)-5-amino-N-[(2S)-1-[[(2S)-1-(4-aminobutylamino)-1-oxo-3-phenylpropan-2-yl]-methylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-N,5-dimethylhex-2-enamide (PubChem CID 10393978) has the molecular formula C37H49N5O3 and a molecular weight of 611.83 g/mol. Its IUPAC name is (E)-5-amino-N-[(2S)-1-[[(2S)-1-(4-aminobutylamino)-1-oxo-3-phenylpropan-2-yl]-methylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-N,5-dimethylhex-2-enamide.
| Compound Name | (E)-5-amino-N-[(2S)-1-[[(2S)-1-(4-aminobutylamino)-1-oxo-3-phenylpropan-2-yl]-methylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-N,5-dimethylhex-2-enamide |
|---|---|
| PubChem CID | 10393978 |
| Molecular Formula | C37H49N5O3 |
| Molecular Weight | 611.83 g/mol |
| Exact Mass | 611.38 |
| IUPAC Name | (E)-5-amino-N-[(2S)-1-[[(2S)-1-(4-aminobutylamino)-1-oxo-3-phenylpropan-2-yl]-methylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-N,5-dimethylhex-2-enamide |
| SMILES | CN(C(=O)/C=C/CC(C)(C)N)[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)N(C)[C@@H](Cc1ccccc1)C(=O)NCCCCN |
| InChI | InChI=1S/C37H49N5O3/c1-37(2,39)23-13-18-34(43)41(3)33(27-29-19-21-31(22-20-29)30-16-9-6-10-17-30)36(45)42(4)32(26-28-14-7-5-8-15-28)35(44)40-25-12-11-24-38/h5-10,13-22,32-33H,11-12,23-27,38-39H2,1-4H3,(H,40,44)/b18-13+/t32-,33-/m0/s1 |
| InChIKey | GARVGWQHRZRJPU-GFPZKVLASA-N |
| XLogP | 4.33 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.83 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|