C15H20FNO2 — CID 103940047
N-(3-cyclopentylpropyl)-2-fluoro-4-hydroxybenzamide (PubChem CID 103940047) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is N-(3-cyclopentylpropyl)-2-fluoro-4-hydroxybenzamide.
| Compound Name | N-(3-cyclopentylpropyl)-2-fluoro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 103940047 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-(3-cyclopentylpropyl)-2-fluoro-4-hydroxybenzamide |
| SMILES | O=C(NCCCC1CCCC1)c1ccc(O)cc1F |
| InChI | InChI=1S/C15H20FNO2/c16-14-10-12(18)7-8-13(14)15(19)17-9-3-6-11-4-1-2-5-11/h7-8,10-11,18H,1-6,9H2,(H,17,19) |
| InChIKey | CNNMGCIYNWLSFI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|