C30H22F6N2O4S — CID 10394100
(5E)-5-[[1-[3-[3,5-bis(trifluoromethyl)phenoxy]propyl]-5-phenylmethoxyindol-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 10394100) has the molecular formula C30H22F6N2O4S and a molecular weight of 620.57 g/mol. Its IUPAC name is (5E)-5-[[1-[3-[3,5-bis(trifluoromethyl)phenoxy]propyl]-5-phenylmethoxyindol-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[1-[3-[3,5-bis(trifluoromethyl)phenoxy]propyl]-5-phenylmethoxyindol-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10394100 |
| Molecular Formula | C30H22F6N2O4S |
| Molecular Weight | 620.57 g/mol |
| Exact Mass | 620.12 |
| IUPAC Name | (5E)-5-[[1-[3-[3,5-bis(trifluoromethyl)phenoxy]propyl]-5-phenylmethoxyindol-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2cc3cc(OCc4ccccc4)ccc3n2CCCOc2cc(C(F)(F)F)cc(C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C30H22F6N2O4S/c31-29(32,33)20-13-21(30(34,35)36)15-24(14-20)41-10-4-9-38-22(16-26-27(39)37-28(40)43-26)11-19-12-23(7-8-25(19)38)42-17-18-5-2-1-3-6-18/h1-3,5-8,11-16H,4,9-10,17H2,(H,37,39,40)/b26-16+ |
| InChIKey | WLLXILBQQSBDNT-WGOQTCKBSA-N |
| XLogP | 8.05 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.57 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|