C12H9Cl2NO4S — CID 103942191
(1R)-1-[5-(2,5-dichlorophenoxy)-4-nitrothiophen-2-yl]ethanol (PubChem CID 103942191) has the molecular formula C12H9Cl2NO4S and a molecular weight of 334.18 g/mol. Its IUPAC name is (1R)-1-[5-(2,5-dichlorophenoxy)-4-nitrothiophen-2-yl]ethanol.
| Compound Name | (1R)-1-[5-(2,5-dichlorophenoxy)-4-nitrothiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 103942191 |
| Molecular Formula | C12H9Cl2NO4S |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | (1R)-1-[5-(2,5-dichlorophenoxy)-4-nitrothiophen-2-yl]ethanol |
| SMILES | C[C@@H](O)c1cc([N+](=O)[O-])c(Oc2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C12H9Cl2NO4S/c1-6(16)11-5-9(15(17)18)12(20-11)19-10-4-7(13)2-3-8(10)14/h2-6,16H,1H3/t6-/m1/s1 |
| InChIKey | HTKFUFUMBSDYEB-ZCFIWIBFSA-N |
| XLogP | 4.81 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|