C32H64O6Si3 — CID 10394224
(2E,4S,6E,8S,9S,10E)-8,9,12-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(methoxymethoxy)dodeca-2,6,10-trien-5-one (PubChem CID 10394224) has the molecular formula C32H64O6Si3 and a molecular weight of 629.12 g/mol. Its IUPAC name is (2E,4S,6E,8S,9S,10E)-8,9,12-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(methoxymethoxy)dodeca-2,6,10-trien-5-one.
| Compound Name | (2E,4S,6E,8S,9S,10E)-8,9,12-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(methoxymethoxy)dodeca-2,6,10-trien-5-one |
|---|---|
| PubChem CID | 10394224 |
| Molecular Formula | C32H64O6Si3 |
| Molecular Weight | 629.12 g/mol |
| Exact Mass | 628.40 |
| IUPAC Name | (2E,4S,6E,8S,9S,10E)-8,9,12-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(methoxymethoxy)dodeca-2,6,10-trien-5-one |
| SMILES | C/C=C/[C@H](OCOC)C(=O)/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H64O6Si3/c1-18-20-27(35-25-34-11)26(33)22-23-29(38-41(16,17)32(8,9)10)28(37-40(14,15)31(5,6)7)21-19-24-36-39(12,13)30(2,3)4/h18-23,27-29H,24-25H2,1-17H3/b20-18+,21-19+,23-22+/t27-,28-,29-/m0/s1 |
| InChIKey | HUKXUBSYPRSQNV-SXAPNXMBSA-N |
| XLogP | 9.04 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.12 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|