C11H9F4N3O — CID 103946610
2,3,5,6-tetrafluoro-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]pyridin-4-amine (PubChem CID 103946610) has the molecular formula C11H9F4N3O and a molecular weight of 275.21 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 103946610 |
| Molecular Formula | C11H9F4N3O |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]pyridin-4-amine |
| SMILES | Cc1cnc(C(C)Nc2c(F)c(F)nc(F)c2F)o1 |
| InChI | InChI=1S/C11H9F4N3O/c1-4-3-16-11(19-4)5(2)17-8-6(12)9(14)18-10(15)7(8)13/h3,5H,1-2H3,(H,17,18) |
| InChIKey | DIXDEZXCJCLZDT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|