C13H21FN2O2S — CID 103947611
N-[3-[1-(2-fluorophenyl)propylamino]propyl]methanesulfonamide (PubChem CID 103947611) has the molecular formula C13H21FN2O2S and a molecular weight of 288.39 g/mol. Its IUPAC name is N-[3-[1-(2-fluorophenyl)propylamino]propyl]methanesulfonamide.
| Compound Name | N-[3-[1-(2-fluorophenyl)propylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 103947611 |
| Molecular Formula | C13H21FN2O2S |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-[3-[1-(2-fluorophenyl)propylamino]propyl]methanesulfonamide |
| SMILES | CCC(NCCCNS(C)(=O)=O)c1ccccc1F |
| InChI | InChI=1S/C13H21FN2O2S/c1-3-13(11-7-4-5-8-12(11)14)15-9-6-10-16-19(2,17)18/h4-5,7-8,13,15-16H,3,6,9-10H2,1-2H3 |
| InChIKey | UUSCBLHZVQKFKZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|