C32H31Cl2F6N3O3 — CID 10394882
N-[(2Z)-3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-methoxyiminopentyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 10394882) has the molecular formula C32H31Cl2F6N3O3 and a molecular weight of 690.51 g/mol. Its IUPAC name is N-[(2Z)-3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-methoxyiminopentyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(2Z)-3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-methoxyiminopentyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 10394882 |
| Molecular Formula | C32H31Cl2F6N3O3 |
| Molecular Weight | 690.51 g/mol |
| Exact Mass | 689.16 |
| IUPAC Name | N-[(2Z)-3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-methoxyiminopentyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CO/N=C(\CNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(CCN1CCC(O)(c2ccccc2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C32H31Cl2F6N3O3/c1-46-42-28(19-41-29(44)21-15-23(31(35,36)37)18-24(16-21)32(38,39)40)25(20-7-8-26(33)27(34)17-20)9-12-43-13-10-30(45,11-14-43)22-5-3-2-4-6-22/h2-8,15-18,25,45H,9-14,19H2,1H3,(H,41,44)/b42-28+ |
| InChIKey | TUUDVKRGCJZJKQ-VSMKPTLZSA-N |
| XLogP | 7.92 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.51 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|