C16H32N2O3 — CID 103949538
tert-butyl 3-(6-hydroxyhexylamino)piperidine-1-carboxylate (PubChem CID 103949538) has the molecular formula C16H32N2O3 and a molecular weight of 300.44 g/mol. Its IUPAC name is tert-butyl 3-(6-hydroxyhexylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(6-hydroxyhexylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103949538 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | tert-butyl 3-(6-hydroxyhexylamino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(NCCCCCCO)C1 |
| InChI | InChI=1S/C16H32N2O3/c1-16(2,3)21-15(20)18-11-8-9-14(13-18)17-10-6-4-5-7-12-19/h14,17,19H,4-13H2,1-3H3 |
| InChIKey | DVQMIRCCHVWIKL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|