C42H48N4O6 — CID 10395008
methyl (2S)-2-[[(2S)-3-methyl-2-[[(2S)-2-[[(2S)-1-(2-naphthalen-2-yl-2-oxoethyl)piperidine-2-carbonyl]amino]-3-phenylpropanoyl]amino]butanoyl]amino]-3-phenylpropanoate (PubChem CID 10395008) has the molecular formula C42H48N4O6 and a molecular weight of 704.87 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-3-methyl-2-[[(2S)-2-[[(2S)-1-(2-naphthalen-2-yl-2-oxoethyl)piperidine-2-carbonyl]amino]-3-phenylpropanoyl]amino]butanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[(2S)-3-methyl-2-[[(2S)-2-[[(2S)-1-(2-naphthalen-2-yl-2-oxoethyl)piperidine-2-carbonyl]amino]-3-phenylpropanoyl]amino]butanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10395008 |
| Molecular Formula | C42H48N4O6 |
| Molecular Weight | 704.87 g/mol |
| Exact Mass | 704.36 |
| IUPAC Name | methyl (2S)-2-[[(2S)-3-methyl-2-[[(2S)-2-[[(2S)-1-(2-naphthalen-2-yl-2-oxoethyl)piperidine-2-carbonyl]amino]-3-phenylpropanoyl]amino]butanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCCN1CC(=O)c1ccc2ccccc2c1)C(C)C |
| InChI | InChI=1S/C42H48N4O6/c1-28(2)38(41(50)44-35(42(51)52-3)25-30-16-8-5-9-17-30)45-39(48)34(24-29-14-6-4-7-15-29)43-40(49)36-20-12-13-23-46(36)27-37(47)33-22-21-31-18-10-11-19-32(31)26-33/h4-11,14-19,21-22,26,28,34-36,38H,12-13,20,23-25,27H2,1-3H3,(H,43,49)(H,44,50)(H,45,48)/t34-,35-,36-,38-/m0/s1 |
| InChIKey | IMEXFJHTHFZXSS-KOILXBFDSA-N |
| XLogP | 4.65 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.87 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |